A0663812
Ammonium thioglycolate solution , Reagent level, 70%solution , 5421-46-5
Synonym(s):
Thioglycolic acid ammonium salt
CAS NO.：5421-46-5
Empirical Formula: C2H7NO2S
Molecular Weight: 109.15
MDL number: MFCD00137451
EINECS: 226-540-9
| Pack Size | Price | Stock | Quantity |
| 25ml | RMB31.20 | In Stock |
|
| 100ml | RMB63.20 | In Stock |
|
| 250ML | RMB80.00 | In Stock |
|
| 500ML | RMB144.00 | In Stock |
|
| 1L | RMB263.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-139.5 °C |
| Boiling point: | 115℃[at 101 325 Pa] |
| Density | 1.22 |
| vapor pressure | 0.001Pa at 25℃ |
| form | Solution |
| Specific Gravity | 1.245 (25℃) |
| color | Clear colorless |
| Odor | strong skunk-like odor |
| Water Solubility | Miscible |
| InChI | InChI=1S/C2H4O2S.H3N/c3-2(4)1-5;/h5H,1H2,(H,3,4);1H3 |
| InChIKey | JYAVWXRMOOCSOD-UHFFFAOYSA-N |
| SMILES | C([O-])(=O)CS.[NH4+] |
| LogP | -2.99 at 20℃ |
Description and Uses
Ammonium thioglycolate, also known as perm salt, is the chemical compound with the formula HSCH2CO2NH4. Being the salt of a weak acid and weak base, ammonium thioglycolic acid exists in solution as an equilibrium mixture of the salt itself as well as the free carboxylic acid thioglycolic acid (HSCH2CO2H) and ammonia : HSCH2COO- + NH4+ ? HSCH2COOH + NH3.
acts as a reducing agent in permanent-waving formulations for hair treatment and in shrink-resistant treatment of wool.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H290-H301-H317 |
| Precautionary statements | P280-P301+P310+P330-P302+P352 |
| Hazard Codes | T |
| Risk Statements | 25-43 |
| Safety Statements | 36/37-45-37-24 |
| RIDADR | 2810 |
| WGK Germany | 1 |
| RTECS | AI7525000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29309090 |
| Toxicity | LD50 ipr-rat: 165 mg/kg JPETAB 97,349,49 |
