Acetylthiocholine iodide , 98% , 1866-15-5
Synonym(s):
(2-Mercaptoethyl)trimethylammonium iodide acetate
CAS NO.：1866-15-5
Empirical Formula: C7H16INOS
Molecular Weight: 289.18
MDL number: MFCD00011819
EINECS: 217-474-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB209.60 | In Stock |
|
| 25G | RMB781.60 | In Stock |
|
| 100g | RMB3079.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 205-210 °C(lit.) |
| Density | 1.4885 (estimate) |
| storage temp. | 2-8°C |
| solubility | H2O: 100 mg/mL |
| form | powder |
| color | white |
| Sensitive | Light Sensitive & Hygroscopic |
| BRN | 3916578 |
| InChI | InChI=1S/C7H16NOS.HI/c1-7(9)10-6-5-8(2,3)4;/h5-6H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | NTBLZMAMTZXLBP-UHFFFAOYSA-M |
| SMILES | [N+](C)(C)(C)CCSC(=O)C.[I-] |
Description and Uses
Acetylthiocholine iodide, also known as ATCI, serves as both an acetylcholinesterase (AChE) substrate and a nicotinic acetylcholine receptor (AChR) agonist. ATCI itself is a colorless and odorless compound. It exhibits solubility in both water and ethanol. It is a synthetic compound extensively employed in laboratory experiments to measure the activity of AChE, a vital enzyme responsible for the breakdown of the neurotransmitter acetylcholine (ACh) in the central and peripheral nervous systems. Additionally, it enables the evaluation of drug effects on AChE activity and facilitates investigations into the impact of toxins on the nervous system. Acetylthiocholine iodide functions as an inhibitor of AChE. By binding to the enzyme′s active site, it prevents AChE from catalyzing the breakdown of ACh. Consequently, ACh accumulates in the synaptic cleft, leading to increased neuron excitability. This inhibition of AChE by ATCI ultimately results in a higher ACh concentration within the synaptic cleft, yielding a range of physiological effects. These effects encompass heightened muscle contraction, increased heart rate and blood pressure, elevated salivation, intensified bronchial secretions, and augmented gastrointestinal activity[1].
Substrate for the colorimetric determination of acetylcholinesterase activity.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311 |
| Precautionary statements | P264-P270-P280-P301+P310-P302+P352+P312-P361+P364 |
| Hazard Codes | T,Xi |
| Risk Statements | 21-25-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | FZ9865000 |
| F | 3-8-10 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309099 |
