PRODUCT Properties
| Melting point: | 97-100 °C (lit.) |
| Boiling point: | 303.85°C (rough estimate) |
| Density | 1.4251 (rough estimate) |
| refractive index | 1.6404 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| color | Yellow |
| Water Solubility | Insoluble in water. |
| BRN | 1869747 |
| InChI | InChI=1S/C14H9Br/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
| InChIKey | ZIRVQSRSPDUEOJ-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C3C(=C2Br)C=CC=C3)=CC=C1 |
Description and Uses
9-bromoanthracene is a kind of bromine-derived anthracene. It is known to be able to reversibly photodimerize in a head-to tail fashion upon irradiation by long-wavelength ultraviolet light. The photodimers of 9-bromoanthracene are suitable to be used as alkyl halide initiators in the atom transfer radical polymerization (ATRP) reactions. It is also used as the intermediate for the preparation of the 9-substitued form of the polycyclic aromatic hydrocarbon (PAH) anthracene.
9-Bromoanthracene acts as an intermediate in the preparation of 9-substituted derivative of the polycyclic aromatic hydrocarbon (PAH) anthracene.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H341 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29049090 |
