T9615030
1,1,1,2,2,4,5,5,5-Nonafluoro-4-(trifluoromethyl)-3-pentanone , >98.0%(GC) , 756-13-8
CAS NO.：756-13-8
Empirical Formula: C6F12O
Molecular Weight: 316.04
MDL number: MFCD04038343
EINECS: 436-710-6
| Pack Size | Price | Stock | Quantity |
| 25g | RMB464.00 | In Stock |
|
| 100g | RMB1596.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -108°C |
| Boiling point: | 49°C |
| Density | 1,6 g/cm3 |
| vapor pressure | 31.6-40.4kPa at 20-25℃ |
| solubility | Chloroform (Soluble), Methanol (Sparingly) |
| form | clear liquid |
| Specific Gravity | 1.6 |
| color | Colorless to Almost colorless |
| Water Solubility | 24-332.6mg/L at 25℃ |
| InChI | InChI=1S/C6F12O/c7-2(4(10,11)12,5(13,14)15)1(19)3(8,9)6(16,17)18 |
| InChIKey | RMLFHPWPTXWZNJ-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C(F)(F)C(=O)C(F)(C(F)(F)F)C(F)(F)F |
| LogP | 2.79-5.48 at 20-25℃ |
Description and Uses
Perfluoro(2-methyl-3-pentanone) has outstanding flame retardant effect to prevent burning and is used in the protection of molten magnesium and fire extinguishing agents with no impact on the environment.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H412 |
| Precautionary statements | P261-P273-P280 |
| Hazard Codes | Xi |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 2914790040 |
