PRODUCT Properties
| Melting point: | 225 °C (dec.) (lit.) |
| Boiling point: | 467.67°C (rough estimate) |
| Density | 1.4944 (rough estimate) |
| refractive index | 1.5910 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Dichloromethane (Very Slightly, Heated, Sonicated), DMSO (Slightly) |
| pka | 3.45±0.20(Predicted) |
| form | Solid |
| color | Brown |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C14H6N2O8/c17-7-3-1-5(15(21)22)9-11(7)14(20)12-8(18)4-2-6(16(23)24)10(12)13(9)19/h1-4,17-18H |
| InChIKey | GJCHQJDEYFYWER-UHFFFAOYSA-N |
| SMILES | C1(O)=C2C(C(=O)C3=C(C2=O)C(O)=CC=C3[N+]([O-])=O)=C([N+]([O-])=O)C=C1 |
Description and Uses
1,8-Dihydroxy-4,5-dinitro-9,10-anthracenedione is a NS2B-NS3 protease specific inhibitor that is used for treatment of Dengue and West Nile virus infections.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | CB6700000 |
| TSCA | Yes |
| HS Code | 29147000 |
