T8194630
Chrysophenine , 2870-32-8
Synonym(s):
Direct Yellow 12
CAS NO.：2870-32-8
Empirical Formula: C30H26N4Na2O8S2
Molecular Weight: 680.66
MDL number: MFCD00007488
EINECS: 220-698-2
| Pack Size | Price | Stock | Quantity |
| 25g | RMB392.00 | In Stock |
|
| 500g | RMB1880.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| storage temp. | Amber Vial, Refrigerator, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| Colour Index | 24895 |
| color | Orange to Dark Orange |
| Stability: | Light Sensitive |
| InChIKey | BFMGWSCDIBELQN-BHHUATOHSA-N |
| SMILES | C(C1C=CC(/N=N/C2C=CC(OCC)=CC=2)=CC=1S(O)(=O)=O)=CC1C=CC(/N=N/C2C=CC(OCC)=CC=2)=CC=1S(O)(=O)=O.[NaH] |
| EPA Substance Registry System | C.I. Direct Yellow 12 (2870-32-8) |
Description and Uses
A diazo stilbene dye
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2927.00.5000 |
