PRODUCT Properties
| Melting point: | 65-69 °C |
| Flash point: | 65 °C |
| solubility | Soluble in water, ethanol, acetone, ether, and chloroform. |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| pka | 10.5 |
| color | White to Almost white |
| BRN | 3947083 |
| InChI | InChI=1S/C5H13N.ClH/c1-5(2)3-4-6;/h5H,3-4,6H2,1-2H3;1H |
| InChIKey | HOMVDRDAAUYWKL-UHFFFAOYSA-N |
| SMILES | C(CN)C(C)C.Cl |
Description and Uses
1-Amino-3-methylbutane hydrochloride is an amine compound with a weak base. It has been reported to be an inhibitor of fatty acid synthesis in the liver and heart. Its transport properties were investigated by means of a model system simulating blood flow through a capillary bed.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | NT0200000 |
| F | 3-10 |
| HS Code | 2921.19.6190 |