carotenoidantioxidant , 3351-86-8
Synonym(s):
all-trans-Fucoxanthin
CAS NO.：3351-86-8
Empirical Formula: C42H58O6
Molecular Weight: 658.91
MDL number: MFCD01745140
EINECS: 200-486-6
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB1599.22 | In Stock |
|
| 50mg | RMB6372.50 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 166-168°C |
| alpha | D18 +72.5 ±9° (chloroform) |
| Boiling point: | 590.43°C (rough estimate) |
| Density | 1.09 |
| refractive index | n20/D1.360-1.362 |
| Flash point: | 14℃ |
| storage temp. | -20°C |
| solubility | Ethanol, |
| pka | 14.47±0.60(Predicted) |
| form | Solid |
| color | Crystalline |
| optical activity | +72.518 (CHCl3) |
| λmax | λ: 444-454 nm Amax |
| InChIKey | SJWWTRQNNRNTPU-WEAAWPSVSA-N |
| SMILES | [C@]12(CC(=O)/C(/C)=C/C=C/C(/C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C=C3[C@@](O)(C)C[C@@H](OC(=O)C)CC3(C)C)C(C)(C)C[C@H](O)C[C@]1(O2)C |&1:0,25,29,42,45,r| |
| LogP | 7.830 (est) |
| CAS DataBase Reference | 3351-86-8(CAS DataBase Reference) |
Description and Uses
Fucoxanthin is another important xanthophyll. It is widely found in heterokontophyta, such as brown algae and oceanic microalgae,and is believed be the second-most abundant carotenoid on Earth after β-carotene. Recently, studies on the functionality of fucoxanthin have been increasingly conducted,and fucoxanthin has been shown to possess various beneficial physiological activities.It has various pharmaceutical effects such as anti-tumor, anti-inflammatory, anti-oxidant, anti-obesity effects, protecting nerve cell, increasing the content of ARA(arachidonic acid) and DHA (docosahexaenoic acid) in mice; It is widely used as medicine, skin care and beauty industry, and in the Food supplements market.
Fucoxanthin has been used to study its neuroprotective effects. It has also been used in calibration to identify the most efficient fucoxanthin producing strains of microalgae.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319 |
| Precautionary statements | P210-P280-P305+P351+P338-P337+P313-P403+P235 |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 7-16-24/25 |
| RIDADR | UN1170 - class 3 - PG 2 - Ethanol, solution |
| WGK Germany | 3 |
| HS Code | 29153900 |
