S610679
3-Methylenecyclobutanecarbonitrile , 97%(GC) , 15760-35-7
Synonym(s):
3-Methylene-1-cyanocyclobutane
| Pack Size | Price | Stock | Quantity |
| 5g | RMB779.57 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149-150 ºC |
| Boiling point: | 163.58°C (rough estimate) |
| Density | 0.912 g/mL at 25 °C |
| refractive index | n20/D1.461 |
| Flash point: | 58℃ |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| form | liquid |
| color | Clear, colourless |
| InChI | InChI=1S/C6H7N/c1-5-2-6(3-5)4-7/h6H,1-3H2 |
| InChIKey | ZRWMAMOBIQQJSA-UHFFFAOYSA-N |
| SMILES | C1(C#N)CC(=C)C1 |
Description and Uses
3-Methylenecyanocyclobutane is a compound that can undergo hydrophosphination with phosphine boranes and phosphites to prepare novel cyclobutyl-P derivatives.
Safety
| Symbol(GHS) |   GHS02,GHS06 |
| Signal word | Danger |
| Hazard statements | H226-H301-H312+H332-H315-H317-H319-H335 |
| Precautionary statements | P210-P280-P301+P310+P330-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-43 |
| Safety Statements | 26-36/37/39-36/37-7/9 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2926907090 |
| Toxicity | mouse,LD50,intraperitoneal,250mg/kg (250mg/kg),National Technical Information Service. Vol. AD603-561, |
