PRODUCT Properties
Melting point: | 149-151 °C |
Boiling point: | 443.6±45.0 °C(Predicted) |
Density | 1.13±0.1 g/cm3(Predicted) |
InChI | InChI=1/C21H28O3/c1-13(22)24-19-7-6-17-16-5-4-14-12-15(23)8-10-20(14,2)18(16)9-11-21(17,19)3/h8,10,12,16-19H,4-7,9,11H2,1-3H3/t16-,17-,18-,19-,20-,21-/s3 |
InChIKey | KPCDGGNHYODURF-CRZFGMLKNA-N |
SMILES | [C@]12([H])CC[C@]3(C)[C@H](CC[C@@]3([H])[C@]1([H])CCC1=CC(=O)C=C[C@]21C)OC(=O)C |&1:0,4,6,9,11,21,r| |
Description and Uses
Boldenone 17-acetate is a white or white solid powder, belongs to the hormone class.
The parent of 17-acetate bodanone is a derivative of testosterone and thus inherits most of its properties, such as androgenic ability and protein synthesis.
Safety
Symbol(GHS) | ![]() GHS08 |
Signal word | Warning |
Hazard statements | H351-H373 |
Precautionary statements | P201-P202-P281-P308+P313-P405-P501-P260-P314-P501 |
Hazard Codes | Xn |
Risk Statements | 40-48-48/22 |
Safety Statements | 22-24/25 |
HS Code | 29372900 |