PRODUCT Properties
| Melting point: | 164-166°C |
| alpha | D25 +25° (in chloroform) |
| Boiling point: | 368.77°C (rough estimate) |
| Density | 1.0655 (rough estimate) |
| refractive index | 1.4709 (estimate) |
| storage temp. | Controlled Substance, -20°C Freezer |
| solubility | DMF: 25 mg/ml; DMSO: 15 mg/ml; DMSO:PBS (pH 7.2) (1:1): 0.5 mg/ml; Ethanol: 10 mg/ml |
| form | A crystalline solid |
| pka | 15.05±0.60(Predicted) |
| Water Solubility | 57.1mg/L at 20℃ |
| InChI | InChI=1/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,11,14-17,21H,3-6,8,10H2,1-2H3/t14-,15-,16-,17-,18-,19-/s3 |
| InChIKey | RSIHSRDYCUFFLA-KRHBYBJCNA-N |
| SMILES | [C@@]12([H])CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])O |&1:0,10,12,16,18,21,r| |
Description and Uses
Boldenone (Item No. 15432) is an analytical reference standard categorized as an anabolic androgenic steroid. Anabolic steroids, including boldenone, have been used to enhance physical performance in athletes. Boldenone is regulated as a Schedule III compound in the United States. This product is intended for research and forensic applications.
Controlled substance. Anabolic steroid
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H412-H362-H351-H360 |
| Precautionary statements | P201-P260-P263-P264-P270-P308+P313-P201-P202-P281-P308+P313-P405-P501-P273-P501 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-20/21/22-36 |
| Safety Statements | 16-36/37 |
| RTECS | BV7994400 |
| HS Code | 29372900 |
