M5107348
Azidotributyltin(IV) , 98% , 17846-68-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB262.40 | In Stock |
|
| 5g | RMB870.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 120°C/0.2mmHg |
| Density | 1.212 g/mL at 25 °C(lit.) |
| refractive index | 1.5745 |
| Flash point: | >230 °F |
| solubility | Miscible with toluene, hexane, acetonitrile and tetrahydrofuran. |
| Specific Gravity | 1.212 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/3C4H9.N3.Sn/c3*1-3-4-2;1-3-2;/h3*1,3-4H2,2H3;;/q;;;-1;+1 |
| InChIKey | JKVRTUCVPZTEQZ-UHFFFAOYSA-N |
| SMILES | [Sn](N=[N+]=[N-])(CCCC)(CCCC)CCCC |
Description and Uses
Tributyltin azide is a heterocyclic organic compound that is used in organic synthesis. It has shown antihypertensive activity and the ability to inhibit fatty acid synthesis. Tributyltin azide has also been shown to have biological properties, such as the coordination of proteins and enzymes.
Tributylstannanylium Azide is used in preparation method of Polycaprolactone-based Polyamide composite material.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H312-H315-H319-H360FD-H372-H410 |
| Precautionary statements | P202-P273-P280-P301+P310-P302+P352+P312-P305+P351+P338 |
| Hazard Codes | T,N |
| Risk Statements | 21-25-36/38-48/23/25-50/53 |
| Safety Statements | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 6.1 |
| HS Code | 29319090 |
