Ecdysone , ≥95% , 3604-87-3
Synonym(s):
2β,3β,14α,22(R),25-Pentahydroxy-7-cholesten-6-one
CAS NO.：3604-87-3
Empirical Formula: C27H44O6
Molecular Weight: 464.63
MDL number: MFCD00042683
EINECS: 222-760-4
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB1152.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 242°C |
| alpha | 20578 +62° |
| Boiling point: | 488.1°C (rough estimate) |
| Density | 1.0493 (rough estimate) |
| refractive index | 1.4482 (estimate) |
| storage temp. | 2-8°C |
| solubility | Methanol (Very Slightly, Heated) |
| pka | 14.07±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | +5820 (c 0.1, ethanol) |
| Merck | 13,3525 |
| BRN | 2422986 |
| InChIKey | UPEZCKBFRMILAV-JMZLNJERSA-N |
| SMILES | [C@H]1(C[C@@]2([C@](C)(C[C@@H]1O)[C@]1([H])C([C@]3([C@@](CC1)(C)[C@@H]([C@H](C)[C@@H](CCC(C)(C)O)O)CC3)O)=CC2=O)[H])O |
| LogP | 0.870 (est) |
| CAS DataBase Reference | 3604-87-3(CAS DataBase Reference) |
Description and Uses
?Ecdysterone, also known as ecdysone or β-ecdysone, is a hormone that regulates the growth and development of insects. In 1954, Butenandt et al. isolated 250mg of the initial insect metamorphic active substance, ecdysone, from 500kg of silkworm pupae. Since then, various similar substances have been isolated from many plants. It has been found that ecdysteroids are not only more abundant in the plant kingdom compared to the animal kingdom, but also widely distributed and abundant in resources. Examples of ferns that contain ecdysteroids include Chinese cornbind, Sichuan cornbind, mulberry leaves, Dectenium heterocarpon, water plantain, Ginkgo biloba, yew, Thelypteris palustris, and Cyrtomium falcatum, among others.
α-Ecdysone is a steroidal prohormone.
