M3653235
MelengestrolAcetate , 98% , 2919-66-6
Synonym(s):
17α-Acetoxy-6-methyl-16-methylene-4,6-pregnadiene-3,20-dione;Melengestrol acetate;MGA
CAS NO.：2919-66-6
Empirical Formula: C25H32O4
Molecular Weight: 396.52
MDL number: MFCD00072142
EINECS: 220-859-7
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB502.40 | In Stock |
|
| 100mg | RMB1270.40 | In Stock |
|
| 500mg | RMB3680.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 202-204 °C(lit.) |
| alpha | D23 -127° (c = 0.31 in chloroform) |
| Boiling point: | 440.2°C (rough estimate) |
| Density | 1.0911 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White to Beige |
| BRN | 2066919 |
| InChIKey | UDKABVSQKJNZBH-DWNQPYOZSA-N |
| SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)[C@@](OC(C)=O)(C(=O)C)C(=C)C3)C=C2C |
Description and Uses
antiarrhythmic, cardiotonic, hypertensive, Na/K ATPase inhibitor
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H361fd |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 62 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | TU4141000 |
| HS Code | 29372390 |
| Toxicity | LD50 (mg/kg): >8000 orally in rats; >2500 i.p. in mice (Zimbelman) |
