M3094435
11α-Hydroxycanrenone , 98% , 192569-17-8
CAS NO.：192569-17-8
Empirical Formula: C22H28O4
Molecular Weight: 356.46
MDL number: MFCD09038746
EINECS: 606-276-4
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB216.00 | In Stock |
|
| 25mg | RMB768.00 | In Stock |
|
| 100mg | RMB1222.40 | In Stock |
|
| 1g | RMB1760.00 | In Stock |
|
| 5g | RMB3188.80 | In Stock |
|
| 25g | RMB5504.00 | In Stock |
|
| 100g | RMB11000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232-234°C |
| Boiling point: | 584.7±50.0 °C(Predicted) |
| Density | 1.25 |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.55±0.60(Predicted) |
| color | Pale Yellow to Brown |
| InChIKey | RJTDWMKVQUPGSY-IPRJTMRINA-N |
| SMILES | C[C@]12C[C@@H](O)[C@]3([H])[C@]4(CCC(=O)C=C4C=C[C@@]3([H])[C@]1([H])CC[C@]12CCC(=O)O1)C |&1:1,3,5,7,16,18,22,r| |
| CAS DataBase Reference | 192569-17-8(CAS DataBase Reference) |
Description and Uses
11α-Hydroxy Canrenone is the key intermediate in the synthesis of Eplerenone, a cardiovascular drug. Canrenone was biotransformed into 11α-Hydroxycanrenone by Aspergillus ochraceus SIT34205.
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H351-H411 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501 |
