![N-[4-[[(2-Amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]formylamino]benzoyl]-L-glutamic acid](https://img.chemicalbook.com/CAS/GIF/134-05-4.gif)
LN4434932
N-[4-[[(2-Amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]formylamino]benzoyl]-L-glutamic acid , 95% , 134-05-4
Synonym(s):
N-[4-[[(2-Amino-1,4-dihydro-4-oxo-6-pteridinyl)methyl]formylamino]benzoyl]-L -glutamic acid;Formylfolic acid
| Pack Size | Price | Stock | Quantity |
| 0.1g | RMB400.00 | In Stock |
|
| 0.25g | RMB800.00 | In Stock |
|
| 0.5g | RMB1200.00 | In Stock |
|
| 1g | RMB2000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >193°C (dec.) |
| Density | 1.67±0.1 g/cm3(Predicted) |
| storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly, Heated, Sonicated), Methanol (Very Slightly, Heated) |
| pka | 3.41±0.10(Predicted) |
| color | Pale Orange to Brown |
| Stability: | Light Sensitive |
| InChIKey | UGWUWNVTCLDEOG-VHLFKADZNA-N |
| SMILES | C(O)(=O)[C@H](CCC(O)=O)NC(=O)C1=CC=C(N(CC2C=NC3=C(N=2)C(=O)NC(N)=N3)C=O)C=C1 |&1:3,r| |
Description and Uses
As a Folic acid (F680300) derivative (or folate) found in daily dietary intake, 10-Formylfolic Acid is often used in cancer risk correlation studies.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P261-P285-P304+P341-P342+P311-P501 |
| HS Code | 2936299055 |
