LN1786141
Testosteronecypionate , 58-20-8
Synonym(s):
4-Androsten-17β-ol-3-one 17-cypionate;Depotestosterone;Depovirin;Testosterone 17β-cyclopentanepropionate;Testosterone 17β-cypionate
CAS NO.：58-20-8
Empirical Formula: C27H40O3
Molecular Weight: 412.6
MDL number: MFCD00053944
EINECS: 200-368-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB498.40 | In Stock |
|
| 25g | RMB1572.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-102° |
| alpha | D25 +87° (CHCl3) |
| Boiling point: | 492.01°C (rough estimate) |
| Density | 0.9795 (rough estimate) |
| refractive index | 1.5460 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMF: 25 mg/mL; DMSO: 5 mg/mL; Ethanol: 15 mg/mL; Ethanol:PBS (pH 7.2)(1:2): 0.3 mg/mL |
| form | A crystalline solid |
| InChIKey | HPFVBGJFAYZEBE-ZLQWOROUSA-N |
| SMILES | [C@@]12([H])CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])OC(=O)CCC1CCCC1 |&1:0,10,12,16,18,21,r| |
Description and Uses
Testosterone Cypionate is an anabolic steroid with androgenic properties. Testosterone Cypionate is used for testosterone therapy in males with hypogonadism. Controlled Substance.
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H351-H361-H410 |
| Precautionary statements | P201-P273-P301+P312+P330-P308+P313 |
| Hazard Codes | T |
| Risk Statements | 45-63 |
| Safety Statements | 53-22-26-36 |
| WGK Germany | 3 |
| RTECS | XA3066000 |
| HS Code | 2937290000 |
