LN-939026
GDC-0077 , 0.99summer , 2060571-02-8
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 698.0±65.0 °C(Predicted) |
| Density | 1.63±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMSO:110.0(Max Conc. mg/mL);245.47(Max Conc. mM) |
| pka | 15.89±0.50(Predicted) |
| form | Solid |
| color | Off-white to yellow |
| InChIKey | SGEUNORSOZVTOL-CABZTGNLSA-N |
| SMILES | C(N)(=O)[C@@H](NC1C=C2OCCN3C=C(N4[C@H](C(F)F)COC4=O)N=C3C2=CC=1)C |
Description and Uses
Inavolisib, or GDC-0077, is a potent and selective PI3K inhibitor. GDC-0077 blocks an enzyme involved in cancer growth called PI3K. GDC0077 binds to and inhibits various members of the PI3K family, including activating mutations in the catalytic alpha isoform PIK3CA. PI3K inhibition prevents the activation of the PI3K-mediated signaling pathway and inhibits the growth and survival of PI3K-overexpressing tumor cells. The IUPAC name of this compound is (S)-2-((2-((S)-4-(difluoromethyl)-2-oxooxazolidin-3-yl)-5,6-dihydrobenzo[f]imidazo[1,2-d][1,4]oxazepin-9-yl)amino)propanamide.
