LN-414725
Acetyl Tetrapeptide-40 , 98% , 1472633-28-5
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 1041.5±65.0 °C(Predicted) |
| Density | 1.374±0.06 g/cm3(Predicted) |
| pka | 3.19±0.10(Predicted) |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | NAWVSZKPXFAPHT-CWRJVFHYSA-N |
| SMILES | C(O)(=O)[C@H]([C@H](O)C)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H]([C@H](O)C)NC(=O)[C@H](C)NC(C)=O |
Description and Uses
Acetyl Tetrapeptide-40 is a compound of four amino acids. Like other tetrapeptides, Acetyl Tetrapeptide-40 is pharmacologically active. In the skin, the compound inhibits the release of interleukins.
Acetyl Tetrapeptide-40 counteracts these inflammatory effects. Thus, the compound visibly reduces unwanted skin redness and veins.

