BD9989255
Iron(III)2-Ethylhexanoate , nominally50%inmineralspirits,Fe6% , 7321-53-1
CAS NO.：7321-53-1
Empirical Formula: C24H45FeO6
Molecular Weight: 485.455
MDL number: MFCD00014006
EINECS: 230-794-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB31.20 | In Stock |
|
| 25g | RMB96.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 400℃[at 101 325 Pa] |
| Density | 0.91 |
| Flash point: | 41℃ |
| storage temp. | Refrigerator |
| form | Liquid |
| Water Solubility | Miscible with chloroform. Immiscible with water. |
| Exposure limits | ACGIH: TWA 100 ppm OSHA: TWA 500 ppm(2900 mg/m3) NIOSH: IDLH 20000 mg/m3; TWA 350 mg/m3; Ceiling 1800 mg/m3 |
| InChI | InChI=1S/3C8H16O2.Fe/c3*1-3-5-6-7(4-2)8(9)10;/h3*7H,3-6H2,1-2H3,(H,9,10);/q;;;+3/p-3 |
| InChIKey | ULUYRVWYCIOFRV-UHFFFAOYSA-K |
| SMILES | [Fe](OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC |
| LogP | 5.59 at 20℃ |
| EPA Substance Registry System | Ferric 2-ethylhexanoate (7321-53-1) |
Description and Uses
Iron(III) 2-ethylhexanoate is used as a catalyst used in polymerization reactions. It also serves as a mild Lewis acid catalyst for the stereoselective Diels-Alder reaction. Further, it acts as Ziegler-Natta type catalyst system involved in the polymerization of 1,3-butadiene.
Safety
| Symbol(GHS) |   GHS02,GHS08 |
| Hazard statements | H226-H304-H340-H350-H372 |
| Precautionary statements | P210-P260-P301+P310a-P303+P361+P353-P405-P501a |
| RIDADR | UN1993 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | III |
