BD9901755
Maropitantcitratehydrate , 98+% , 359875-09-5
Synonym(s):
Cefixim Tellurite Supplement;Tellurite Cefixim Supplement
CAS NO.：359875-09-5
Empirical Formula: C32H40N2O.C6H8O7.H2O
Molecular Weight:
MDL number: MFCD02098080
EINECS: 201-069-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB91.20 | In Stock |
|
| 250mg | RMB136.00 | In Stock |
|
| 1g | RMB340.00 | In Stock |
|
| 5g | RMB1189.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-159 °C(lit.) |
| Flash point: | 100 °C |
| storage temp. | 2-8°C |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| form | white to off-white crystalline powder |
| Water Solubility | Water: 3 mg/mL (4.42 mM) |
| InChIKey | XDZPFSKCXRGRIO-OHTRWSNQNA-N |
| SMILES | C(O)(C(=O)O)(CC(=O)O)CC(=O)O.C(C1C=CC=CC=1)(C1C=CC=CC=1)[C@@H]1N2CCC(CC2)[C@@H]1NCC1C=C(C(C)(C)C)C=CC=1OC |&1:26,33,r| |
Description and Uses
Maropitant citrate hydrate is a specific neurokinin-1 (NK-1) receptor antagonist that selectively inhibits the production of substance P, a mediator involved in signalling vomiting. Maropitant citrate was therefore originally used to treat vomiting in dogs and cats. Currently, it is also used as an adjunct to visceral analgesia in dogs and cats, and in other species such as horses and birds.
Anti-emetic.
Safety
| Symbol(GHS) |    GHS08,GHS09,GHS05 |
| Signal word | Danger |
| Hazard statements | H400-H373-H318-H410 |
| Precautionary statements | P273-P391-P501-P273-P391-P501-P260-P314-P501-P280-P305+P351+P338-P310 |
| Hazard Codes | Xi,T |
| Risk Statements | 41-42/43-36/37/38-25 |
| Safety Statements | 26-39-45-36/37-22 |
| RIDADR | UN 3284 6.1/PG 3 |
| WGK Germany | 1 |
| RTECS | GE7350000 |
| F | 9 |
