BD9575931
(E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide , 97% , 863127-76-8
CAS NO.：863127-76-8
Empirical Formula: C12H14ClNO2
Molecular Weight: 239.7
MDL number: MFCD13185963
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB35.20 | In Stock |
|
| 1g | RMB87.20 | In Stock |
|
| 5g | RMB270.40 | In Stock |
|
| 10g | RMB453.60 | In Stock |
|
| 25g | RMB912.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 386.5±42.0 °C(Predicted) |
| Density | 1.197 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 11.57±0.70(Predicted) |
| InChI | InChI=1S/C12H14ClNO2/c1-3-16-8-7-11(15)14-12-9(2)5-4-6-10(12)13/h4-8H,3H2,1-2H3,(H,14,15)/b8-7+ |
| InChIKey | DBYFNZJHXGNAGW-BQYQJAHWSA-N |
| SMILES | C(NC1=C(C)C=CC=C1Cl)(=O)/C=C/OCC |
Description and Uses
(2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxy-2-propenamide is a reagent used for the preparation of potent and selective anti-tumor drug Dasatinib.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2924297099 |
![N-(2-Chloro-6-methylphenyl)-2-[(6-chloro-2-methyl-4-pyrimidinyl)amino]-5-thiazolecarboxamide](https://img.chemicalbook.com/CAS/GIF/302964-08-5.gif)
