BD9554147
TetrapropylammoniumBisulfate , 97+% , 56211-70-2
Synonym(s):
Tetrapropylammonium hydrogen sulfate
CAS NO.：56211-70-2
Empirical Formula: C12H29NO4S
Molecular Weight: 283.43
MDL number: MFCD00038764
EINECS: 200-144-5
| Pack Size | Price | Stock | Quantity |
| 500g | RMB3428.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-160 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| λmax | λ: 210 nm Amax: 0.05 λ: 220 nm Amax: 0.04 λ: 230 nm Amax: 0.03 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| Sensitive | Hygroscopic |
| BRN | 6833419 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C12H28N.H2O4S/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-5(2,3)4/h5-12H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | MOXJKKOSZCHGEU-UHFFFAOYSA-M |
| SMILES | [N+](CCC)(CCC)(CCC)CCC.S(O)([O-])(=O)=O |
Description and Uses
Tetrapropylammonium Bisulfate is used in the preparation of a room temperature ionic liquid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
