BD9531831
(1S,4R)-1-Methyl-4-(prop-1-en-2-yl)cyclohex-2-enol , 97% , 22972-51-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB48.80 | In Stock |
|
| 5g | RMB164.00 | In Stock |
|
| 10g | RMB312.00 | In Stock |
|
| 25g | RMB719.20 | In Stock |
|
| 100g | RMB2828.00 | In Stock |
|
| 500g | RMB10508.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 69-70 °C(Press: 3 Torr) |
| Density | 0.9398 |
| Flash point: | 87.0±19.6 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Soluble), Methanol (Soluble) |
| pka | 14.66±0.40(Predicted) |
| form | Oil |
| color | Colourless |
| Water Solubility | 4.2g/L |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C10H16O/c1-8(2)9-4-6-10(3,11)7-5-9/h4,6,9,11H,1,5,7H2,2-3H3/t9-,10+/m0/s1 |
| InChIKey | MKPMHJQMNACGDI-VHSXEESVSA-N |
| SMILES | [C@@]1(C)(O)CC[C@@H](C(C)=C)C=C1 |
| LogP | 2.82 |
Description and Uses
1-Methyl-4-(1-methylethenyl)-2-cyclohexen-1-ol is an acetal reagent used in the synthesis of desoxy cannabidiols and THC (T293202) related psychoactive compounds. It is formed from (+)-Limonene using a photosynthesized O2 transfer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| HS Code | 2906190090 |
