BD9513731
6-Fluoro-4-(trifluoromethyl)quinolin-2(1H)-one , 97% , 328956-08-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB145.60 | In Stock |
|
| 1g | RMB378.40 | In Stock |
|
| 5g | RMB1372.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 252-253 °C (decomp)(Solv: ethanol (64-17-5)) |
| Boiling point: | 282 ºC |
| Density | 1.468 |
| Flash point: | 124 ºC |
| storage temp. | 2-8°C |
| pka | 9.33±0.70(Predicted) |
| InChI | InChI=1S/C10H5F4NO/c11-5-1-2-8-6(3-5)7(10(12,13)14)4-9(16)15-8/h1-4H,(H,15,16) |
| InChIKey | WUFRBOSKPZUGIS-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(F)C=C2)C(C(F)(F)F)=CC1=O |
Description and Uses
As a quinoline derivative, 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline is substituted with trifluoromethyl, hydroxyl, and fluoride groups. In particular, 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline can exist in a tautomeric form, known as quinolone, where the hydroxy group becomes a ketone and the imine changes to an amine. This compound is a precursor for synthesizing thioquinolines, which are used to develop non-cytotoxic, potent and selective antitubercular agents. The thiolation reaction is carried out using phosphorus pentasulfide in pyridine.
Safety
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 29334900 |
