BD9496031
5'-O-(4,4'-Dimethoxytrityl)-N6-benzoyl-2'-deoxyadenosine-3'-(2-cyanoethyl-N,N-diisopropyl)phosphoramidite , 95% , 98796-53-3
Synonym(s):
DMT-dA(bz) Phosphoramidite;N6-Benzoyl-5′-O-(4,4′-dimethoxytrityl)-2′-deoxyadenosine-3′-O-[O-(2-cyanoethyl)-N,N′-diisopropylphosphoramidite];N-benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-2′-deoxyadenosine, 3′-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite];Adenosine, N-benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-2′-deoxy-, 3′-[2-cyanoethyl bis(1-methylethyl)phosphoramidite];Adenosine, N-benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-2′-deoxy-, 3′-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite]
CAS NO.：98796-53-3
Empirical Formula: C47H52N7O7P
Molecular Weight: 857.93
MDL number: MFCD00036314
EINECS: 685-521-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB38.40 | In Stock |
|
| 1g | RMB92.00 | In Stock |
|
| 5g | RMB453.60 | In Stock |
|
| 10g | RMB812.00 | In Stock |
|
| 25g | RMB1644.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.23 at 20℃ |
| vapor pressure | 0-0Pa at 20-50℃ |
| storage temp. | Sealed in dry,2-8°C |
| solubility | soluble, clear |
| form | powder or granules |
| pka | 7.87±0.43(Predicted) |
| color | white to off-white |
| InChIKey | GGDNKEQZFSTIMJ-AKWFTNRHSA-N |
| SMILES | O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C3C(=C(N=CN=3)NC(=O)C3=CC=CC=C3)N=C2)C[C@@H]1OP(N(C(C)C)C(C)C)OCCC#N |
| LogP | 7.14 at 20℃ |
Description and Uses
N6-Benzoyl-2’-deoxy-5’-O-DMT-cytidine 3’-CE Phosphoramidite is used to prepare antisense oligonucleotides containing conformationally constrained methoxyaminomethylene and aminooxymethylene and aminomethylene bridged nucleoside analogs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 29349990 |
