![(2-Methyl-[1,1'-biphenyl]-3-yl)methanol](https://img.chemicalbook.com/CAS/GIF/76350-90-8.gif)
BD9228431
(2-Methyl-[1,1'-biphenyl]-3-yl)methanol , 97% , 76350-90-8
CAS NO.：76350-90-8
Empirical Formula: C14H14O
Molecular Weight: 198.26
MDL number: MFCD00134200
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB28.80 | In Stock |
|
| 25g | RMB44.80 | In Stock |
|
| 100g | RMB130.40 | In Stock |
|
| 500g | RMB606.40 | In Stock |
|
| 1000g | RMB1032.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-76 °C(lit.) |
| Boiling point: | 330.9±11.0 °C(Predicted) |
| Density | 1.072±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.28±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C14H14O/c1-11-13(10-15)8-5-9-14(11)12-6-3-2-4-7-12/h2-9,15H,10H2,1H3 |
| InChIKey | BGTLHJPGBIVQLJ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=CC(CO)=C1C |
| CAS DataBase Reference | 76350-90-8(CAS DataBase Reference) |
| EPA Substance Registry System | [1,1'-Biphenyl]-3-methanol, 2-methyl- (76350-90-8) |
Description and Uses
2-Methyl-3-biphenylmethanol is a pharmaceutical intermediate and organic chemical synthesis reagent, which can be used in the preparation of drugs such as Bifenthrin and PD-L1 inhibitors, and also in the synthesis of other organic compounds such as 2-methyl-3-phenylphenethylboronic acid pinacol ester, biphenyl-1,2,3-triazole couplings and biphenyl alcohols.
Bifenthrin intermediate.
Safety
| WGK Germany | 3 |
| HS Code | 2906290090 |
