BD8837455
Sodiumhexafluorophosphate , 99% , 21324-39-0
CAS NO.：21324-39-0
Empirical Formula: F6NaP
Molecular Weight: 167.95
MDL number: MFCD00011122
EINECS: 244-333-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB43.20 | In Stock |
|
| 25g | RMB117.60 | In Stock |
|
| 100g | RMB384.80 | In Stock |
|
| 500g | RMB1510.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >200 °C (lit.) |
| Density | 2.369 g/mL at 25 °C (lit.) |
| solubility | H2O: soluble5%, clear, colorless |
| form | Crystals |
| Specific Gravity | 3.375 |
| color | White to light gray |
| PH | 2.0-4.0 |
| Water Solubility | SOLUBLE |
| Sensitive | Hygroscopic |
| Stability: | Stable. Incompatible with strong acids. |
| InChI | InChI=1S/F6P.Na/c1-7(2,3,4,5)6;/q-1;+1 |
| InChIKey | KMADQUOCJBLXRP-UHFFFAOYSA-N |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].[Na+] |
Description and Uses
Sodium hexafluorophosphate is used as an ion pairing agent for the determination of cobalt(II) in water samples. It is used as an important raw material in the preparation of 2-chloro-1,3-bis(dimethylamino)trimethinium hexafluorophosphate.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H314 |
| Precautionary statements | P260-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C,Xi |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3260 8/PG 2 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 28269090 |
