BD8789231
4-Methoxycyclohexanone , 97% , 13482-23-0
CAS NO.：13482-23-0
Empirical Formula: C7H12O2
Molecular Weight: 128.17
MDL number: MFCD01110115
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB92.80 | In Stock |
|
| 1g | RMB197.60 | In Stock |
|
| 5g | RMB693.60 | In Stock |
|
| 10g | RMB1340.80 | In Stock |
|
| 25g | RMB3258.40 | In Stock |
|
| 100g | RMB8364.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 189 ºC |
| Density | 0.98 |
| refractive index | 1.4560 |
| Flash point: | 69 ºC |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, Ethyl Acetate, Methanol |
| form | liquid |
| color | Clear, pale yellow |
| InChI | InChI=1S/C7H12O2/c1-9-7-4-2-6(8)3-5-7/h7H,2-5H2,1H3 |
| InChIKey | XADCKKKOYZJNAR-UHFFFAOYSA-N |
| SMILES | C1(=O)CCC(OC)CC1 |
Description and Uses
4-Methoxycyclohexanone is a substituted cyclohexanone used in the preparation of various organic compounds such as antitumor agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P305+P351+P338-P362+P364 |
| HS Code | 2914500090 |
