BD8543131
(2R,3S,5R)-5-(4-Benzamido-2-oxopyrimidin-1(2H)-yl)-2-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite , 98% , 102212-98-6
Synonym(s):
Cytidine, N-benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-2′-deoxy-, 3′-[2-cyanoethyl bis(1-methylethyl)phosphoramidite];DMT-dC(bz) amidite;N4-Benzoyl-5′-O-(4,4′-dimethoxytrityl)-2′-deoxycytidine-3′-O-[O-(2-cyanoethyl)-N,N′-diisopropylphosphoramidite];N-benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-2′-deoxycytidine, 3′-[2-cyanoethyl N,N-?bis(1-methylethyl)phosphoramidite]
CAS NO.：102212-98-6
Empirical Formula: C46H52N5O8P
Molecular Weight: 833.91
MDL number: MFCD00036315
EINECS: 801-520-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB37.60 | In Stock |
|
| 1g | RMB97.60 | In Stock |
|
| 5g | RMB336.00 | In Stock |
|
| 25g | RMB1276.00 | In Stock |
|
| 100g | RMB4592.00 | In Stock |
|
| 500g | RMB18368.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >84°C (dec.) |
| Density | 1.23 at 20℃ |
| vapor pressure | 0-0Pa at 20-50℃ |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform, DMSO, Methanol (Slightly) |
| form | powder or granules |
| pka | 8.65±0.20(Predicted) |
| color | white to off-white |
| InChIKey | PGTNFMKLGRFZDX-SALLYJDFSA-N |
| SMILES | O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C=CC(NC(=O)C3=CC=CC=C3)=NC2=O)C[C@@H]1OP(N(C(C)C)C(C)C)OCCC#N |&1:25,27,45,r| |
| LogP | 6.5 at 20℃ |
Description and Uses
5'-O-DMT-N4-Benzoyl-2'-deoxycytidine 3'-CE phosphoramidite is used to prepare antisense oligonucleotides containing conformationally constrained methoxyaminomethylene and aminooxymethylene and aminomethylene bridged nucleoside analogs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
