BD8257431
Ethyl 2-chloropyrimidine-5-carboxylate , 98% , 89793-12-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB28.80 | In Stock |
|
| 1g | RMB40.80 | In Stock |
|
| 5g | RMB120.00 | In Stock |
|
| 10g | RMB232.00 | In Stock |
|
| 25g | RMB495.20 | In Stock |
|
| 100g | RMB1811.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-60℃ |
| Boiling point: | 80℃/760mm |
| Density | 1.311±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| pka | -3.05±0.22(Predicted) |
| form | Solid |
| color | White to Light yellow |
| InChI | InChI=1S/C7H7ClN2O2/c1-2-12-6(11)5-3-9-7(8)10-4-5/h3-4H,2H2,1H3 |
| InChIKey | IEMKQRSOAOPKRJ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(C(OCC)=O)C=N1 |
| CAS DataBase Reference | 89793-12-4 |
Description and Uses
Ethyl 2-chloropyrimidine-5-carboxylate is used in the synthesis of Retinoid x receptor agonists (RXR) that are used in the treatment of cancers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
