BD7983531
Apigenin 7-Glucoside , 99+% , 578-74-5
Synonym(s):
4′,5,7-Trihydroxyflavone 7-glucoside;Apigenin 7-glucoside;Apigetrin;Cosmosiin
CAS NO.：578-74-5
Empirical Formula: C21H20O10
Molecular Weight: 432.38
MDL number: MFCD00016787
EINECS: 209-430-5
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB524.80 | In Stock |
|
| 50mg | RMB786.40 | In Stock |
|
| 100mg | RMB1257.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230-237°C |
| Boiling point: | 788.9±60.0 °C(Predicted) |
| Density | 1.642±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly) |
| pka | 6.13±0.40(Predicted) |
| form | Solid |
| color | Pale Yellow to Yellow |
| BRN | 65669 |
| Stability: | Hygroscopic |
| InChIKey | KMOUJOKENFFTPU-YUVSVTSJNA-N |
| SMILES | C1(C2=CC=C(O)C=C2)OC2=C(C(=CC(OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)=C2)O)C(=O)C=1 |&1:17,20,22,24,r| |
| LogP | -0.040 (est) |
| CAS DataBase Reference | 578-74-5(CAS DataBase Reference) |
Description and Uses
Apigenin 7-Glucoside is a by-product during the synthesis of Isorhoifolin (I819700), a naturally occurring flavonoid that was shown to exhibit potential antidiabetic, antihyperlipidemic and antioxidant effects.
