BD7739031
(S)-2-Amino-3-(6-chloro-1H-indol-3-yl)propanoic acid , 98% , 33468-35-8
CAS NO.：33468-35-8
Empirical Formula: C11H11ClN2O2
Molecular Weight: 238.67
MDL number: MFCD02683925
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB255.20 | In Stock |
|
| 250mg | RMB380.00 | In Stock |
|
| 1g | RMB1174.40 | In Stock |
|
| 5g | RMB4697.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 244-246°C |
| Boiling point: | 476.9±45.0 °C(Predicted) |
| Density | 1.474±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Aqueous Acid (Slightly), Methanol (Very Slightly, Heated) |
| form | Solid |
| pka | 2.22±0.10(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C11H11ClN2O2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m0/s1 |
| InChIKey | FICLVQOYKYBXFN-VIFPVBQESA-N |
| SMILES | C(O)(=O)[C@H](CC1C2=C(C=C(Cl)C=C2)NC=1)N |
| CAS DataBase Reference | 33468-35-8 |
Description and Uses
The natural enantiomer of Chlorotryptophan.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933998090 |
