BD5131141
2-Chloromalonaldehyde , 98% , 36437-19-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB376.80 | In Stock |
|
| 5g | RMB1134.40 | In Stock |
|
| 10g | RMB1704.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-145 °C |
| Boiling point: | 111℃ |
| Density | 1.261 |
| refractive index | 1.4100 (estimate) |
| Flash point: | 32℃ |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly, Heated), Methanol (Slightly) |
| pka | 1.48±0.10(Predicted) |
| form | Crystalline Powder |
| color | Brown |
| InChI | InChI=1S/C3H3ClO2/c4-3(1-5)2-6/h1-3H |
| InChIKey | KTRZQCIGJUWSGE-UHFFFAOYSA-N |
| SMILES | C(=O)C(Cl)C=O |
Description and Uses
2-Chloromalonaldehyde is used in the synthesis of novel heterocyclic acetyl coenzyme-A carboxylase inhibitors. Also used in the production of aldose reductase inhibitors used in the treatment of diabetes mellitus.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26 |
| RIDADR | 1759 |
| HS Code | 29130000 |
