BD4905141
4-Bromo-3-fluoro-2-methylaniline , 97% , 127408-03-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB204.80 | In Stock |
|
| 5g | RMB601.60 | In Stock |
|
| 10g | RMB1147.20 | In Stock |
|
| 25g | RMB1888.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 244.5±35.0 °C(Predicted) |
| Density | 1.589±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| pka | 2.73±0.10(Predicted) |
| form | crystalline solid |
| color | Pink |
| InChI | InChI=1S/C7H7BrFN/c1-4-6(10)3-2-5(8)7(4)9/h2-3H,10H2,1H3 |
| InChIKey | HOFKRNFFIGAFNE-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C(F)=C1C |
Description and Uses
4-Bromo-3-fluoro-2-methylaniline can be used as pharmaceutical raw material and organic synthesis raw material.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P260-P280 |
| RIDADR | UN2811 |
| HS Code | 2921420090 |