BD4715841
Methyl4-hydroxy-7-phenoxyisoquinoline-3-carboxylate , 97% , 1455091-10-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB208.00 | In Stock |
|
| 1g | RMB600.00 | In Stock |
|
| 5g | RMB1794.40 | In Stock |
|
| 25g | RMB6203.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 534.7±45.0 °C(Predicted) |
| Density | 1.320±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 5.80±0.50(Predicted) |
| InChI | InChI=1S/C17H13NO4/c1-21-17(20)15-16(19)14-8-7-13(9-11(14)10-18-15)22-12-5-3-2-4-6-12/h2-10,19H,1H3 |
| InChIKey | YTWDBRIDKWWANA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(OC3=CC=CC=C3)=C2)C(O)=C(C(OC)=O)N=1 |
Description and Uses
Methyl 4-Hydroxy-7-phenoxyisoquinoline-3-carboxylate is an intermediate of N-[(4-Hydroxy-1-methyl-7-phenoxy-3-isoquinolinyl)carbonyl]glycine (H948180), a hypoxia-inducible factor (HIF) prolyl hydroxylase inhibitor used to increase white blood cell levels in blood and hematopoietic progenitor cells in bone marrow.
