BD4558641
N-(1-Cyclohexen-1-yl)morpholine , 97% , 670-80-4
Synonym(s):
4-(1-Cyclohexen-1-yl)morpholine
CAS NO.：670-80-4
Empirical Formula: C10H17NO
Molecular Weight: 167.25
MDL number: MFCD00006163
EINECS: 211-579-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25g | RMB67.20 | In Stock |
|
| 100g | RMB240.80 | In Stock |
|
| 500g | RMB874.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 118-120 °C10 mm Hg(lit.) |
| Density | 0.995 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 155 °F |
| storage temp. | 2-8°C |
| pka | 6.33±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| BRN | 118696 |
| InChI | InChI=1S/C10H17NO/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h4H,1-3,5-9H2 |
| InChIKey | IIQFBBQJYPGOHJ-UHFFFAOYSA-N |
| SMILES | N1(C2CCCCC=2)CCOCC1 |
| CAS DataBase Reference | 670-80-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Morpholine, 4-(1-cyclohexen-1-yl)-(670-80-4) |
| EPA Substance Registry System | Morpholine, 4-(1-cyclohexen-1-yl)- (670-80-4) |
Description and Uses
1-Morpholinocyclohexene (N-(1-Cyclohexen-1-yl)morpholine) falls under the category of organic compounds called morpholine class of heterocyclic amines. This colorless liquid possesses a distinct amine-like odor and displays remarkable versatility with widespread applications in multiple industries, including agrochemicals and cosmetics. Moreover, it is a valuable solvent, corrosion inhibitor, and integral component in lubricants[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 9 |
| TSCA | Yes |
| HS Code | 29349990 |
