BD3593841
(tert-Butyldimethylsilyloxy)acetaldehyde , 90%(GC) , 102191-92-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB40.00 | In Stock |
|
| 1g | RMB96.80 | In Stock |
|
| 5g | RMB383.20 | In Stock |
|
| 10g | RMB679.20 | In Stock |
|
| 25g | RMB1571.20 | In Stock |
|
| 100g | RMB4747.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-167 ºC |
| Boiling point: | 165-167 °C(lit.) |
| Density | 0.915 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 140 °F |
| storage temp. | 2-8°C |
| form | Powder |
| color | White to light beige to grey |
| Specific Gravity | 0.915 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| InChI | InChI=1S/C8H18O2Si/c1-8(2,3)11(4,5)10-7-6-9/h6H,7H2,1-5H3 |
| InChIKey | MEBFFOKESLAUSJ-UHFFFAOYSA-N |
| SMILES | C(=O)CO[Si](C(C)(C)C)(C)C |
Description and Uses
Employed in the construction of the key tetrahydropyran subunit in a recent synthesis of the marine natural product (–)-dactylodide.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1989 3/PG 3 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29319090 |
