BD3481745
4-(Pyridin-3-yl)pyrimidin-2-amine , 97% , 66521-66-2
CAS NO.：66521-66-2
Empirical Formula: C9H8N4
Molecular Weight: 172.19
MDL number: MFCD01317832
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB28.00 | In Stock |
|
| 1g | RMB57.60 | In Stock |
|
| 5g | RMB232.00 | In Stock |
|
| 10g | RMB448.00 | In Stock |
|
| 25g | RMB945.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-191 °C |
| Boiling point: | 439.9±37.0 °C(Predicted) |
| Density | 1.259±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.76±0.10(Predicted) |
| color | Off-White to Pale Yellow |
| InChI | InChI=1S/C9H8N4/c10-9-12-5-3-8(13-9)7-2-1-4-11-6-7/h1-6H,(H2,10,12,13) |
| InChIKey | LQHQKYWYKPLKCH-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC(C2=CC=CN=C2)=N1 |
Description and Uses
4-(3-Pyridinyl)-2-pyrimidinamine serves as an intermediate compound during the synthesis of Nilotinib. Nilotinib is a selective tyrosine kinase receptor inhibitor used in the therapy of chronic myelogenous leukemia.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | T |
| Risk Statements | 25-20/21/22 |
| Safety Statements | 45-36/37 |
| HS Code | 29339900 |
