BD3064457
2,3,5,6,8,9,11,12,14,15-Decahydrobenzo[b][1,4,7,10,13,16]hexaoxacyclooctadecin-18-amine , 98% , 68941-06-0
Synonym(s):
(Benzo-18-crown-6)-4′-ylamine
Pack Size | Price | Stock | Quantity |
100mg | RMB216.00 | In Stock |
|
250mg | RMB367.20 | In Stock |
|
1g | RMB991.20 | In Stock |
|
others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
Melting point: | 53-56 °C |
Boiling point: | 511.9±50.0 °C(Predicted) |
Density | 1.099±0.06 g/cm3(Predicted) |
storage temp. | 0-6°C |
pka | 4.62±0.20(Predicted) |
BRN | 5296463 |
InChI | InChI=1S/C16H25NO6/c17-14-1-2-15-16(13-14)23-12-10-21-8-6-19-4-3-18-5-7-20-9-11-22-15/h1-2,13H,3-12,17H2 |
InChIKey | PZXYILUXRGTFGD-UHFFFAOYSA-N |
SMILES | O1C2=CC=C(N)C=C2OCCOCCOCCOCCOCC1 |
Description and Uses
4′-Aminophenyl-18-crown-6 is a cyclic compound. It is widely used as an ion carrier. It coordinates to metal ions more easily than other ligands because its planar oxygen atoms provide a strong negative potential barrier. 4'-aminobenzo-18-Crown-6 (AB18C6) could be used to design and fabricate a novel magnetic absorbent for absorption and determination of lead metal ion (Pb2+) based on a self-assembly approach via the dehydration condensation[1].
Safety
Symbol(GHS) | ![]() GHS07 |
Signal word | Warning |
Hazard statements | H315-H319-H335 |
Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
Hazard Codes | Xi |
Risk Statements | 36/37/38 |
Safety Statements | 26-36 |
WGK Germany | 3 |
F | 8-10 |