BD3029248
cis-2,6-Dimethylmorpholine , 97% , 6485-55-8
CAS NO.：6485-55-8
Empirical Formula: C6H13NO
Molecular Weight: 115.17
MDL number: MFCD00078428
EINECS: 229-353-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB41.60 | In Stock |
|
| 10g | RMB57.60 | In Stock |
|
| 25g | RMB136.00 | In Stock |
|
| 100g | RMB377.60 | In Stock |
|
| 500g | RMB1796.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -85 °C |
| Boiling point: | 140-142 °C |
| Density | 0.93 |
| vapor pressure | 3.38-5.4hPa at 15.1-21.9℃ |
| refractive index | 1.445-1.447 |
| Flash point: | 41 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Sparingly), Dichloromethane (Sparingly), Methanol (Slightly) |
| form | Liquid |
| pka | 9.04±0.60(Predicted) |
| color | Clear colorless |
| BRN | 878182 |
| InChI | InChI=1/C6H13NO/c1-5-3-7-4-6(2)8-5/h5-7H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | HNVIQLPOGUDBSU-OLQVQODUNA-N |
| SMILES | N1C[C@H](C)O[C@H](C)C1 |&1:2,5,r| |
| LogP | -0.15 at 25℃ |
Description and Uses
cis-2,6-Dimethylmorphine is used in the synthesis of p38α MAP kinase inhibitors used in the treatment of autoimmune diseases. Also used towards the synthesis of potent agonists and antagonists of 5-HT 4 receptors.
Safety
| Symbol(GHS) |     GHS02,GHS05,GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H311-H318-H303-H312 |
| Precautionary statements | P303+P361+P353-P305+P351+P338-P310a-P501a-P210-P233-P240-P241+P242+P243-P280-P302+P352+P312+P361+P364-P305+P351+P338+P310-P370+P378-P403+P235-P405-P501 |
| Hazard Codes | C,Xn |
| Risk Statements | 34-21/22-10-41-37/38-22 |
| Safety Statements | 45-36/37/39-26-23-39 |
| RIDADR | 1993 |
| RTECS | QE1750000 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29339900 |
