BD2800648
Diethyl5-ethylpyridine-2,3-dicarboxylate , 95% , 105151-39-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB49.60 | In Stock |
|
| 25g | RMB168.00 | In Stock |
|
| 100g | RMB553.60 | In Stock |
|
| 500g | RMB2048.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 180-190 °C(Press: 5-7 Torr) |
| Density | 1.120±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO, Methanol (Slightly) |
| pka | -0.20±0.10(Predicted) |
| form | Oil |
| color | Clear Light Yellow to Yellow |
| InChI | InChI=1S/C13H17NO4/c1-4-9-7-10(12(15)17-5-2)11(14-8-9)13(16)18-6-3/h7-8H,4-6H2,1-3H3 |
| InChIKey | VSPXTWXXNZJEHM-UHFFFAOYSA-N |
| CAS DataBase Reference | 105151-39-1(CAS DataBase Reference) |
Description and Uses
Diethyl 5-Ethylpyridine-2,3-dicarboxylate is used as a reagent for the preparation of midazolinylpyridinecarboxylic acid from pyridinedicarboxylate and aminobutyramide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | F |
