BD1432032
Ethyl 3-oxo-4-phenylbutanoate , 95% , 718-08-1
CAS NO.：718-08-1
Empirical Formula: C12H14O3
Molecular Weight: 206.24
MDL number: MFCD03844818
EINECS: 226-500-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB59.20 | In Stock |
|
| 250mg | RMB84.80 | In Stock |
|
| 1g | RMB109.60 | In Stock |
|
| 5g | RMB464.80 | In Stock |
|
| 10g | RMB808.80 | In Stock |
|
| 25g | RMB1961.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 290℃ |
| Density | 1.091 |
| refractive index | 1.054-1.059 |
| Flash point: | 124℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Sparingly) |
| form | Oil |
| pka | 10.49±0.46(Predicted) |
| color | Colourless to Light Yellow |
| InChI | InChI=1S/C12H14O3/c1-2-15-12(14)9-11(13)8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | BOZNWXQZCYZCSH-UHFFFAOYSA-N |
| SMILES | C1(C=CC=CC=1)CC(=O)CC(=O)OCC |
Description and Uses
Ethyl 3-oxo-4-phenylbutanoate is a useful synthetic intermediate. It is used to prepare pyrazolone derivatives as antiprion compounds. It is also used to prepare pyrrolinylaminopyrimidine analogs as inhibitors of AP-1 and NF-κB mediated gene expression.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
