BD1389332
cis-3-(2-Chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid , 97% , 72748-35-7
CAS NO.：72748-35-7
Empirical Formula: C9H10ClF3O2
Molecular Weight: 242.62
MDL number: MFCD04112623
EINECS: 266-275-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB42.40 | In Stock |
|
| 25g | RMB52.00 | In Stock |
|
| 100g | RMB153.60 | In Stock |
|
| 500g | RMB712.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-109°C |
| Boiling point: | 271.6±40.0 °C(Predicted) |
| Density | 1.152 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Sparingly, Sonicated), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.91±0.42(Predicted) |
| color | White to Off-White |
| InChI | InChI=1/C9H10ClF3O2/c1-8(2)4(6(8)7(14)15)3-5(10)9(11,12)13/h3-4,6H,1-2H3,(H,14,15)/t4-,6-/s3 |
| InChIKey | SPVZAYWHHVLPBN-BNFWCSRPNA-N |
| SMILES | [C@@H]1(C(O)=O)[C@H](C=C(Cl)C(F)(F)F)C1(C)C |&1:0,4,r| |
| CAS DataBase Reference | 72748-35-7(CAS DataBase Reference) |
Description and Uses
Reagent used in the synthesis of cyhalothric pesticides and fungicides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
