BD1087832
1,2,4,5-Tetrabromo-3,6-dimethylbenzene , 97% , 23488-38-2
CAS NO.：23488-38-2
Empirical Formula: C8H6Br4
Molecular Weight: 421.75
MDL number: MFCD00010353
EINECS: 245-688-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB52.00 | In Stock |
|
| 5g | RMB156.80 | In Stock |
|
| 10g | RMB285.60 | In Stock |
|
| 25g | RMB608.80 | In Stock |
|
| 100g | RMB2107.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 254-256 °C(lit.) |
| Boiling point: | 303.01°C (rough estimate) |
| Density | 2.258 |
| refractive index | 1.7040 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Heated) |
| form | Solid |
| color | Off-White |
| InChI | InChI=1S/C8H6Br4/c1-3-5(9)7(11)4(2)8(12)6(3)10/h1-2H3 |
| InChIKey | RXKOKVQKECXYOT-UHFFFAOYSA-N |
| SMILES | C1(Br)=C(C)C(Br)=C(Br)C(C)=C1Br |
Description and Uses
2,3,5,6-Tetrabromo-p-xylene is a novel chemical flame retardant which may act as an environmental pollutant and contaminant such as within the endangered European eel (Anguilla anguilla) species.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| RTECS | ZE5170000 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2903998090 |
