BD0813032
2-Bromo-4-chloro-1-methylbenzene , 98% , 27139-97-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB27.20 | In Stock |
|
| 10g | RMB40.00 | In Stock |
|
| 25g | RMB62.40 | In Stock |
|
| 100g | RMB234.40 | In Stock |
|
| 500g | RMB884.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-77°C |
| Boiling point: | 112°C 20mm |
| Density | 1,54 g/cm3 |
| refractive index | 1.5720-1.5760 |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| Specific Gravity | 1.54 |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C7H6BrCl/c1-5-2-3-6(9)4-7(5)8/h2-4H,1H3 |
| InChIKey | CSUUXPHPCXHYGY-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(Cl)C=C1Br |
| CAS DataBase Reference | 27139-97-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P280a-P305+P351+P338-P321-P332+P313-P337+P313-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-51/53-22-36/38 |
| Safety Statements | 26-36/37/39-61-37 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
