BD0798753
3,6,9,12,15,18,21,24,27,30-Decaoxadotriacontane-1,32-diol , 98% , 6809-70-7
CAS NO.：6809-70-7
Empirical Formula: C22H46O12
Molecular Weight: 502.593
MDL number: MFCD26793839
EINECS: 2298848
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB79.20 | In Stock |
|
| 250mg | RMB96.00 | In Stock |
|
| 1g | RMB284.80 | In Stock |
|
| 5g | RMB820.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 571.4±45.0 °C(Predicted) |
| Density | 1.116±0.06 g/cm3(Predicted) |
| pka | 14.06±0.10(Predicted) |
| form | Liquid |
| color | Colorless to light yellow |
| InChI | InChI=1S/C22H46O12/c23-1-3-25-5-7-27-9-11-29-13-15-31-17-19-33-21-22-34-20-18-32-16-14-30-12-10-28-8-6-26-4-2-24/h23-24H,1-22H2 |
| InChIKey | PSVXZQVXSXSQRO-UHFFFAOYSA-N |
| SMILES | C(O)COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO |
Description and Uses
PEG12 is a PEG chain consisting of 12 ethylene glycol subunits and two terminal hydroxyl groups. The hydroxyl groups can participate in reactions to further derivatize the compound. The hydrophilic PEG chain increases the water solubility of the compound in aqueous media. The water solubility properties of the PEG linker are enhanced with longer PEG chains.
