BD0771253
(R)-rel-2,5,7,8-Tetramethyl-2-((4R,8R)-4,8,12-trimethyltridecyl)chroman-6-ylacetate , 98% , 52225-20-4
Synonym(s):
DL -α-Tocopherol acetate;all-rac-α-Tocopheryl acetate;Vitamin E acetate
CAS NO.：52225-20-4
Empirical Formula: C31H52O3
Molecular Weight: 472.74
MDL number: MFCD00072042
EINECS: 257-757-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB56.00 | In Stock |
|
| 100g | RMB137.60 | In Stock |
|
| 500g | RMB509.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -27.5° |
| Boiling point: | bp0.01 184°; bp0.025 194°; bp0.3 224° |
| Density | 0.96 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform, Ethanol (Sparingly), Methanol (Sparingly) |
| form | Viscous Liquid |
| color | Clear light yellow to light green |
| Stability: | Light Sensitive |
| InChI | InChI=1/C31H52O3/c1-21(2)13-10-14-22(3)15-11-16-23(4)17-12-19-31(9)20-18-28-26(7)29(33-27(8)32)24(5)25(6)30(28)34-31/h21-23H,10-20H2,1-9H3/t22-,23-,31-/s3 |
| InChIKey | ZAKOWWREFLAJOT-FDQWOHIBNA-N |
| SMILES | [C@@]1(C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)OC2=C(C)C(C)=C(OC(=O)C)C(C)=C2CC1 |&1:0,5,10,r| |
Description and Uses
dl-α-Tocopherol Acetate is the racemic analog of α-Tocopherol Acetate (T526155), one of the most bioactive of the naturally occurring forms of Vitamin E. Richest sources are green vegetables, grains, and oils, particularly palm, safflower and sunflower oils.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319 |
| Precautionary statements | P210-P305+P351+P338 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 1 |
| RTECS | GA8747000 |
| F | 8-10-23 |
| HS Code | 29362800 |
