BD0714632
Ethyl 3-amino-1H-pyrazole-4-carboxylate , 95% , 6994-25-8
Synonym(s):
3-Amino-4-carbethoxypyrazole;Ethyl 3-aminopyrazole-4-carboxylate
CAS NO.：6994-25-8
Empirical Formula: C6H9N3O2
Molecular Weight: 155.15
MDL number: MFCD00005238
EINECS: 230-262-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB28.80 | In Stock |
|
| 10g | RMB44.80 | In Stock |
|
| 25g | RMB61.60 | In Stock |
|
| 100g | RMB220.80 | In Stock |
|
| 500g | RMB988.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-107 °C(lit.) |
| Boiling point: | 278.95°C (rough estimate) |
| Density | 1.3092 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| pka | 12.98±0.50(Predicted) |
| form | Crystalline Powder |
| color | White to yellow |
| BRN | 4964 |
| Stability: | Light sensitive |
| InChI | InChI=1S/C6H9N3O2/c1-2-11-6(10)4-3-8-9-5(4)7/h3H,2H2,1H3,(H3,7,8,9) |
| InChIKey | YPXGHKWOJXQLQU-UHFFFAOYSA-N |
| SMILES | N1C=C(C(OCC)=O)C(N)=N1 |
| CAS DataBase Reference | 6994-25-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Amino-4-carbethoxypyrazole(6994-25-8) |
Description and Uses
Ethyl 3-Amino-4-pyrazolecarboxylate (Allopurinol EP Impurity D) is an impurity of Allopurinol (A547300), a pyrazole derivative that has been shown to induce neoplasm immunogenicity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi,Xn,N |
| Risk Statements | 36/37/38-20/21/22-50/53-43 |
| Safety Statements | 26-36-24/25-61-60-36/37 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
