BD0636045
Ethyl6-bromo-5-hydroxy-1-methyl-2-((phenylthio)methyl)-1H-Indole-3-carboxylate , 98% , 131707-24-9
CAS NO.：131707-24-9
Empirical Formula: C19H18BrNO3S
Molecular Weight: 420.32
MDL number: MFCD00378136
EINECS: 629-769-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB69.60 | In Stock |
|
| 10g | RMB118.40 | In Stock |
|
| 25g | RMB238.40 | In Stock |
|
| 100g | RMB680.80 | In Stock |
|
| 500g | RMB2051.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >192°C (dec.) |
| Boiling point: | 570.6±50.0 °C(Predicted) |
| Density | 1.44±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Sparingly, Heated) |
| pka | 7.60±0.40(Predicted) |
| form | Solid |
| color | White to Light Brown |
| InChI | InChI=1S/C19H18BrNO3S/c1-3-24-19(23)18-13-9-17(22)14(20)10-15(13)21(2)16(18)11-25-12-7-5-4-6-8-12/h4-10,22H,3,11H2,1-2H3 |
| InChIKey | DAFNNZWQTJQQAP-UHFFFAOYSA-N |
| SMILES | N1(C)C2=C(C=C(O)C(Br)=C2)C(C(OCC)=O)=C1CSC1=CC=CC=C1 |
Description and Uses
6-Bromo-5-hydroxy-1-methyl-2-[(phenylthio)methyl]-1H-indole-3-carboxylic Acid Ethyl Ester is used to prepare anti-hepatitis B virus activities of Et bromohydroxyindolecarboxylates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H332-H319-H335-H302-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501-P261-P271-P304+P340-P312-P264-P280-P305+P351+P338-P337+P313P |
| HazardClass | IRRITANT |
